C24H32N2O5 — CID 87498695
tert-butyl (3R,4R)-3-formyl-4-[(3S)-3-hydroxy-3-(3-methoxyquinolin-5-yl)propyl]piperidine-1-carboxylate (PubChem CID 87498695) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-formyl-4-[(3S)-3-hydroxy-3-(3-methoxyquinolin-5-yl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-formyl-4-[(3S)-3-hydroxy-3-(3-methoxyquinolin-5-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87498695 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | tert-butyl (3R,4R)-3-formyl-4-[(3S)-3-hydroxy-3-(3-methoxyquinolin-5-yl)propyl]piperidine-1-carboxylate |
| SMILES | COc1cnc2cccc([C@@H](O)CC[C@@H]3CCN(C(=O)OC(C)(C)C)C[C@@H]3C=O)c2c1 |
| InChI | InChI=1S/C24H32N2O5/c1-24(2,3)31-23(29)26-11-10-16(17(14-26)15-27)8-9-22(28)19-6-5-7-21-20(19)12-18(30-4)13-25-21/h5-7,12-13,15-17,22,28H,8-11,14H2,1-4H3/t16-,17-,22+/m1/s1 |
| InChIKey | MRZXFEBBBHJLEB-YVHKJVDXSA-N |
| XLogP | 4.13 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|