C25H34ClN3O4 — CID 143875929
tert-butyl 4-[2-[3-(4-chloro-6-methoxyquinolin-3-yl)propylamino]-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 143875929) has the molecular formula C25H34ClN3O4 and a molecular weight of 476.02 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-(4-chloro-6-methoxyquinolin-3-yl)propylamino]-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-(4-chloro-6-methoxyquinolin-3-yl)propylamino]-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143875929 |
| Molecular Formula | C25H34ClN3O4 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | tert-butyl 4-[2-[3-(4-chloro-6-methoxyquinolin-3-yl)propylamino]-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc2ncc(CCCNC(=O)CC3CCN(C(=O)OC(C)(C)C)CC3)c(Cl)c2c1 |
| InChI | InChI=1S/C25H34ClN3O4/c1-25(2,3)33-24(31)29-12-9-17(10-13-29)14-22(30)27-11-5-6-18-16-28-21-8-7-19(32-4)15-20(21)23(18)26/h7-8,15-17H,5-6,9-14H2,1-4H3,(H,27,30) |
| InChIKey | LAVOHKBNTFLUML-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|