C25H33FN2O4S — CID 69346423
(3S,4S)-1-(2-butylsulfanylethyl)-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid (PubChem CID 69346423) has the molecular formula C25H33FN2O4S and a molecular weight of 476.61 g/mol. Its IUPAC name is (3S,4S)-1-(2-butylsulfanylethyl)-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(2-butylsulfanylethyl)-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69346423 |
| Molecular Formula | C25H33FN2O4S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (3S,4S)-1-(2-butylsulfanylethyl)-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid |
| SMILES | CCCCSCCN1CC[C@H](CCC(=O)c2c(F)cnc3ccc(OC)cc23)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C25H33FN2O4S/c1-3-4-12-33-13-11-28-10-9-17(20(16-28)25(30)31)5-8-23(29)24-19-14-18(32-2)6-7-22(19)27-15-21(24)26/h6-7,14-15,17,20H,3-5,8-13,16H2,1-2H3,(H,30,31)/t17-,20+/m0/s1 |
| InChIKey | BSQROWQYPPDHLJ-FXAWDEMLSA-N |
| XLogP | 4.90 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|