C20H26N2O2 — CID 165341819
(2R)-1-[(3R,4S)-3-ethenylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-ol (PubChem CID 165341819) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2R)-1-[(3R,4S)-3-ethenylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-ol.
| Compound Name | (2R)-1-[(3R,4S)-3-ethenylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 165341819 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2R)-1-[(3R,4S)-3-ethenylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-ol |
| SMILES | C=C[C@H]1CNCC[C@H]1C[C@@H](O)Cc1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H26N2O2/c1-3-14-13-21-8-6-15(14)10-17(23)11-16-7-9-22-20-5-4-18(24-2)12-19(16)20/h3-5,7,9,12,14-15,17,21,23H,1,6,8,10-11,13H2,2H3/t14-,15-,17+/m0/s1 |
| InChIKey | BVKLZDFLKITZHQ-YQQAZPJKSA-N |
| XLogP | 2.95 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|