C20H26N2O3 — CID 21347710
2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 21347710) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21347710 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCNC[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C20H26N2O3/c1-25-17-5-6-19-18(12-17)15(8-10-22-19)4-2-3-14-7-9-21-13-16(14)11-20(23)24/h5-6,8,10,12,14,16,21H,2-4,7,9,11,13H2,1H3,(H,23,24)/t14-,16+/m1/s1 |
| InChIKey | YOSJMJNRAAHUQT-ZBFHGGJFSA-N |
| XLogP | 3.27 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |