C20H26N2O2 — CID 70514644
1-[(3R,4S)-3-ethylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-one (PubChem CID 70514644) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(3R,4S)-3-ethylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-one.
| Compound Name | 1-[(3R,4S)-3-ethylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-one |
|---|---|
| PubChem CID | 70514644 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[(3R,4S)-3-ethylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-one |
| SMILES | CC[C@H]1CNCCC1CC(=O)Cc1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H26N2O2/c1-3-14-13-21-8-6-15(14)10-17(23)11-16-7-9-22-20-5-4-18(24-2)12-19(16)20/h4-5,7,9,12,14-15,21H,3,6,8,10-11,13H2,1-2H3/t14-,15?/m0/s1 |
| InChIKey | IYOBPESMZDYOFK-MLCCFXAWSA-N |
| XLogP | 3.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |