C20H28Cl2N2O2 — CID 3068229
(1R)-3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol;dihydrochloride (PubChem CID 3068229) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is (1R)-3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol;dihydrochloride.
| Compound Name | (1R)-3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 3068229 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (1R)-3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol;dihydrochloride |
| SMILES | C=C[C@H]1CNCC[C@H]1CC[C@@H](O)c1ccnc2ccc(OC)cc12.Cl.Cl |
| InChI | InChI=1S/C20H26N2O2.2ClH/c1-3-14-13-21-10-8-15(14)4-7-20(23)17-9-11-22-19-6-5-16(24-2)12-18(17)19;;/h3,5-6,9,11-12,14-15,20-21,23H,1,4,7-8,10,13H2,2H3;2*1H/t14-,15+,20+;;/m0../s1 |
| InChIKey | ZYMURXZJIFDFLT-OLRZQCFASA-N |
| XLogP | 4.31 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|