C19H23FN2O4 — CID 69362150
4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid (PubChem CID 69362150) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid.
| Compound Name | 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69362150 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2ncc(F)c([C@H](O)CCC3CCNCC3C(=O)O)c2c1 |
| InChI | InChI=1S/C19H23FN2O4/c1-26-12-3-4-16-13(8-12)18(15(20)10-22-16)17(23)5-2-11-6-7-21-9-14(11)19(24)25/h3-4,8,10-11,14,17,21,23H,2,5-7,9H2,1H3,(H,24,25)/t11?,14?,17-/m1/s1 |
| InChIKey | XPCANGWVLKKUHV-KDTYNDQISA-N |
| XLogP | 2.51 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |