C23H27FN2O4 — CID 139996950
methyl 4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-prop-2-ynylpiperidine-3-carboxylate (PubChem CID 139996950) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl 4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-prop-2-ynylpiperidine-3-carboxylate.
| Compound Name | methyl 4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-prop-2-ynylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 139996950 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | methyl 4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-prop-2-ynylpiperidine-3-carboxylate |
| SMILES | C#CCN1CCC(CCC(O)c2c(F)cnc3ccc(OC)cc23)C(C(=O)OC)C1 |
| InChI | InChI=1S/C23H27FN2O4/c1-4-10-26-11-9-15(18(14-26)23(28)30-3)5-8-21(27)22-17-12-16(29-2)6-7-20(17)25-13-19(22)24/h1,6-7,12-13,15,18,21,27H,5,8-11,14H2,2-3H3 |
| InChIKey | CNRVTVULCCQRMT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|