C28H29FN2O4 — CID 21347757
(3R,4R)-1-[3-(3-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 21347757) has the molecular formula C28H29FN2O4 and a molecular weight of 476.55 g/mol. Its IUPAC name is (3R,4R)-1-[3-(3-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[3-(3-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21347757 |
| Molecular Formula | C28H29FN2O4 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (3R,4R)-1-[3-(3-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@H](O)CC[C@@H]3CCN(CC#Cc4cccc(F)c4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C28H29FN2O4/c1-35-22-8-9-26-24(17-22)23(11-13-30-26)27(32)10-7-20-12-15-31(18-25(20)28(33)34)14-3-5-19-4-2-6-21(29)16-19/h2,4,6,8-9,11,13,16-17,20,25,27,32H,7,10,12,14-15,18H2,1H3,(H,33,34)/t20-,25+,27-/m1/s1 |
| InChIKey | VELCFGRNCKBRKK-ZBKJKTKLSA-N |
| XLogP | 4.27 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|