C27H29N3O4 — CID 70175675
(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidine-3-carboxylic acid (PubChem CID 70175675) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70175675 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-4-ylprop-2-ynyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CC[C@@H]3CCN(CC#Cc4ccncc4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H29N3O4/c1-34-21-5-6-25-23(17-21)22(10-14-29-25)26(31)7-4-20-11-16-30(18-24(20)27(32)33)15-2-3-19-8-12-28-13-9-19/h5-6,8-10,12-14,17,20,24,26,31H,4,7,11,15-16,18H2,1H3,(H,32,33)/t20-,24+,26+/m1/s1 |
| InChIKey | GGIDAYXNRSLPTC-PSUQPPDWSA-N |
| XLogP | 3.53 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|