C26H28N2O4S — CID 21347762
(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-3-carboxylic acid (PubChem CID 21347762) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is (3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21347762 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@H](O)CC[C@@H]3CCN(CC#Cc4cccs4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C26H28N2O4S/c1-32-19-7-8-24-22(16-19)21(10-12-27-24)25(29)9-6-18-11-14-28(17-23(18)26(30)31)13-2-4-20-5-3-15-33-20/h3,5,7-8,10,12,15-16,18,23,25,29H,6,9,11,13-14,17H2,1H3,(H,30,31)/t18-,23+,25-/m1/s1 |
| InChIKey | DWEWQFNNZSQHHE-FMNCTDSISA-N |
| XLogP | 4.19 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|