C28H33ClN2O3 — CID 70101697
3-phenylpropyl (3R,4R)-4-[(3R)-3-chloro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylate (PubChem CID 70101697) has the molecular formula C28H33ClN2O3 and a molecular weight of 481.04 g/mol. Its IUPAC name is 3-phenylpropyl (3R,4R)-4-[(3R)-3-chloro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylate.
| Compound Name | 3-phenylpropyl (3R,4R)-4-[(3R)-3-chloro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 70101697 |
| Molecular Formula | C28H33ClN2O3 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-phenylpropyl (3R,4R)-4-[(3R)-3-chloro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylate |
| SMILES | COc1ccc2nccc([C@H](Cl)CC[C@@H]3CCNC[C@@H]3C(=O)OCCCc3ccccc3)c2c1 |
| InChI | InChI=1S/C28H33ClN2O3/c1-33-22-10-12-27-24(18-22)23(14-16-31-27)26(29)11-9-21-13-15-30-19-25(21)28(32)34-17-5-8-20-6-3-2-4-7-20/h2-4,6-7,10,12,14,16,18,21,25-26,30H,5,8-9,11,13,15,17,19H2,1H3/t21-,25+,26-/m1/s1 |
| InChIKey | DBYROCAEVWPHNP-QGUKFAFCSA-N |
| XLogP | 5.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|