C19H22N2O4 — CID 70178018
(3R)-4-[3-(6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid (PubChem CID 70178018) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is (3R)-4-[3-(6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-4-[3-(6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70178018 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (3R)-4-[3-(6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(=O)CCC3CCNC[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C19H22N2O4/c1-25-13-3-4-17-15(10-13)14(7-9-21-17)18(22)5-2-12-6-8-20-11-16(12)19(23)24/h3-4,7,9-10,12,16,20H,2,5-6,8,11H2,1H3,(H,23,24)/t12?,16-/m0/s1 |
| InChIKey | WPDGIPAEKHUFAY-INSVYWFGSA-N |
| XLogP | 2.52 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |