C20H26N2O — CID 163525433
(1S)-3-(3-ethenylpiperidin-4-yl)-2-methyl-1-quinolin-4-ylpropan-1-ol (PubChem CID 163525433) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (1S)-3-(3-ethenylpiperidin-4-yl)-2-methyl-1-quinolin-4-ylpropan-1-ol.
| Compound Name | (1S)-3-(3-ethenylpiperidin-4-yl)-2-methyl-1-quinolin-4-ylpropan-1-ol |
|---|---|
| PubChem CID | 163525433 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1S)-3-(3-ethenylpiperidin-4-yl)-2-methyl-1-quinolin-4-ylpropan-1-ol |
| SMILES | C=CC1CNCCC1CC(C)[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H26N2O/c1-3-15-13-21-10-8-16(15)12-14(2)20(23)18-9-11-22-19-7-5-4-6-17(18)19/h3-7,9,11,14-16,20-21,23H,1,8,10,12-13H2,2H3/t14?,15?,16?,20-/m0/s1 |
| InChIKey | DOIMWEGCWBFZBR-UTVANHSVSA-N |
| XLogP | 3.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|