C21H27N2O+ — CID 131884310
(R)-[(1S,2S,4S,5R)-5-ethenyl-1-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 131884310) has the molecular formula C21H27N2O+ and a molecular weight of 323.46 g/mol. Its IUPAC name is (R)-[(1S,2S,4S,5R)-5-ethenyl-1-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (R)-[(1S,2S,4S,5R)-5-ethenyl-1-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 131884310 |
| Molecular Formula | C21H27N2O+ |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (R)-[(1S,2S,4S,5R)-5-ethenyl-1-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N@+]2(CC)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C21H27N2O/c1-3-15-14-23(4-2)12-10-16(15)13-20(23)21(24)18-9-11-22-19-8-6-5-7-17(18)19/h3,5-9,11,15-16,20-21,24H,1,4,10,12-14H2,2H3/q+1/t15-,16-,20-,21+,23-/m0/s1 |
| InChIKey | ZWDFEKOVELDREA-WARQDNIVSA-N |
| XLogP | 3.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|