C31H39BrN2O — CID 10864436
(S)-[(2R,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentamethylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide (PubChem CID 10864436) has the molecular formula C31H39BrN2O and a molecular weight of 535.57 g/mol. Its IUPAC name is (S)-[(2R,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentamethylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide.
| Compound Name | (S)-[(2R,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentamethylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
|---|---|
| PubChem CID | 10864436 |
| Molecular Formula | C31H39BrN2O |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (S)-[(2R,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentamethylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
| SMILES | C=C[C@H]1C[N+]2(Cc3c(C)c(C)c(C)c(C)c3C)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12.[Br-] |
| InChI | InChI=1S/C31H39N2O.BrH/c1-7-24-17-33(18-28-22(5)20(3)19(2)21(4)23(28)6)15-13-25(24)16-30(33)31(34)27-12-14-32-29-11-9-8-10-26(27)29;/h7-12,14,24-25,30-31,34H,1,13,15-18H2,2-6H3;1H/q+1;/p-1/t24-,25-,30+,31-,33?;/m0./s1 |
| InChIKey | KOOQESFCSIUGEJ-LSYMUBFYSA-M |
| XLogP | 3.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|