C34H33N2O+ — CID 163645351
(R)-[(1R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 163645351) has the molecular formula C34H33N2O+ and a molecular weight of 485.65 g/mol. Its IUPAC name is (R)-[(1R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (R)-[(1R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 163645351 |
| Molecular Formula | C34H33N2O+ |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (R)-[(1R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=CC1C[N@@+]2(Cc3c4ccccc4cc4ccccc34)CCC1CC2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C34H33N2O/c1-2-23-21-36(22-31-27-11-5-3-9-25(27)19-26-10-4-6-12-28(26)31)18-16-24(23)20-33(36)34(37)30-15-17-35-32-14-8-7-13-29(30)32/h2-15,17,19,23-24,33-34,37H,1,16,18,20-22H2/q+1/t23?,24?,33?,34-,36-/m1/s1 |
| InChIKey | IHTMWCSSFCOBDV-UDBVGETNSA-N |
| XLogP | 7.19 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|