C35H35N2O2+ — CID 71679827
(R)-[(2S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 71679827) has the molecular formula C35H35N2O2+ and a molecular weight of 515.68 g/mol. Its IUPAC name is (R)-[(2S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 71679827 |
| Molecular Formula | C35H35N2O2+ |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (R)-[(2S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3c4ccccc4cc4ccccc34)CCC1C[C@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C35H35N2O2/c1-3-23-21-37(22-32-28-10-6-4-8-25(28)18-26-9-5-7-11-29(26)32)17-15-24(23)19-34(37)35(38)30-14-16-36-33-13-12-27(39-2)20-31(30)33/h3-14,16,18,20,23-24,34-35,38H,1,15,17,19,21-22H2,2H3/q+1/t23?,24?,34-,35+,37?/m0/s1 |
| InChIKey | FSWPFXMZMGTSHB-YOCSLMHFSA-N |
| XLogP | 7.19 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|