C34H34N3O2+ — CID 118198883
(R)-[(2S,4R,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 118198883) has the molecular formula C34H34N3O2+ and a molecular weight of 516.67 g/mol. Its IUPAC name is (R)-[(2S,4R,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S,4R,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 118198883 |
| Molecular Formula | C34H34N3O2+ |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (R)-[(2S,4R,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1C[N+]2(Cc3c4ccccc4nc4ccccc34)CC[C@@H]1C[C@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C34H34N3O2/c1-3-22-20-37(21-29-25-8-4-6-10-31(25)36-32-11-7-5-9-26(29)32)17-15-23(22)18-33(37)34(38)27-14-16-35-30-13-12-24(39-2)19-28(27)30/h3-14,16,19,22-23,33-34,38H,1,15,17-18,20-21H2,2H3/q+1/t22-,23+,33-,34+,37?/m0/s1 |
| InChIKey | KYDCUUUVEXDDEQ-VKWZMPLPSA-N |
| XLogP | 6.59 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|