C28H33N2O3+ — CID 89493465
(S)-[5-ethenyl-1-[(3-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 89493465) has the molecular formula C28H33N2O3+ and a molecular weight of 445.58 g/mol. Its IUPAC name is (S)-[5-ethenyl-1-[(3-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (S)-[5-ethenyl-1-[(3-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 89493465 |
| Molecular Formula | C28H33N2O3+ |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (S)-[5-ethenyl-1-[(3-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3cccc(OC)c3)CCC1CC2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H33N2O3/c1-4-20-18-30(17-19-6-5-7-22(14-19)32-2)13-11-21(20)15-27(30)28(31)24-10-12-29-26-9-8-23(33-3)16-25(24)26/h4-10,12,14,16,20-21,27-28,31H,1,11,13,15,17-18H2,2-3H3/q+1/t20?,21?,27?,28-,30?/m0/s1 |
| InChIKey | OEYOTWMHROYGHX-LYEGXURLSA-N |
| XLogP | 4.90 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|