C30H37N2O5+ — CID 101457921
(R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 101457921) has the molecular formula C30H37N2O5+ and a molecular weight of 505.64 g/mol. Its IUPAC name is (R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 101457921 |
| Molecular Formula | C30H37N2O5+ |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(OC)c(OC)c(OC)c3)CC[C@H]1C[C@@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C30H37N2O5/c1-6-20-18-32(17-19-13-27(35-3)30(37-5)28(14-19)36-4)12-10-21(20)15-26(32)29(33)23-9-11-31-25-8-7-22(34-2)16-24(23)25/h6-9,11,13-14,16,20-21,26,29,33H,1,10,12,15,17-18H2,2-5H3/q+1/t20-,21-,26+,29+,32+/m0/s1 |
| InChIKey | DNASIGIQVFWSBC-KBNQXEQGSA-N |
| XLogP | 4.91 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|