C26H28Cl2N3O2+ — CID 88900440
(R)-[(2S)-1-[(2,6-dichloro-4-pyridinyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 88900440) has the molecular formula C26H28Cl2N3O2+ and a molecular weight of 485.44 g/mol. Its IUPAC name is (R)-[(2S)-1-[(2,6-dichloro-4-pyridinyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S)-1-[(2,6-dichloro-4-pyridinyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 88900440 |
| Molecular Formula | C26H28Cl2N3O2+ |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (R)-[(2S)-1-[(2,6-dichloro-4-pyridinyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3cc(Cl)nc(Cl)c3)CCC1C[C@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H28Cl2N3O2/c1-3-17-15-31(14-16-10-24(27)30-25(28)11-16)9-7-18(17)12-23(31)26(32)20-6-8-29-22-5-4-19(33-2)13-21(20)22/h3-6,8,10-11,13,17-18,23,26,32H,1,7,9,12,14-15H2,2H3/q+1/t17?,18?,23-,26+,31?/m0/s1 |
| InChIKey | RMYKOXLLYHIZBL-INAKWDKBSA-N |
| XLogP | 5.59 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|