C29H29F6N2O2+ — CID 156594779
(R)-[(2R,4R,5S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 156594779) has the molecular formula C29H29F6N2O2+ and a molecular weight of 551.55 g/mol. Its IUPAC name is (R)-[(2R,4R,5S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2R,4R,5S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 156594779 |
| Molecular Formula | C29H29F6N2O2+ |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | (R)-[(2R,4R,5S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@@H]1C[N+]2(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC[C@@H]1C[C@@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H29F6N2O2/c1-3-18-16-37(15-17-10-20(28(30,31)32)13-21(11-17)29(33,34)35)9-7-19(18)12-26(37)27(38)23-6-8-36-25-5-4-22(39-2)14-24(23)25/h3-6,8,10-11,13-14,18-19,26-27,38H,1,7,9,12,15-16H2,2H3/q+1/t18-,19-,26-,27-,37?/m1/s1 |
| InChIKey | OBQCNRNVWBMHOZ-AXHYOCCWSA-N |
| XLogP | 6.93 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|