C43H35F12N2O2+ — CID 134832685
(S)-[(2R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 134832685) has the molecular formula C43H35F12N2O2+ and a molecular weight of 839.74 g/mol. Its IUPAC name is (S)-[(2R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (S)-[(2R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 134832685 |
| Molecular Formula | C43H35F12N2O2+ |
| Molecular Weight | 839.74 g/mol |
| Exact Mass | 839.25 |
| IUPAC Name | (S)-[(2R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3)CCC1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C43H35F12N2O2/c1-3-24-22-57(9-7-25(24)17-38(57)39(58)35-6-8-56-37-5-4-34(59-2)20-36(35)37)21-23-10-26(28-13-30(40(44,45)46)18-31(14-28)41(47,48)49)12-27(11-23)29-15-32(42(50,51)52)19-33(16-29)43(53,54)55/h3-6,8,10-16,18-20,24-25,38-39,58H,1,7,9,17,21-22H2,2H3/q+1/t24?,25?,38-,39+,57?/m1/s1 |
| InChIKey | FYYTXOBVXILLOM-LHKYDLSPSA-N |
| XLogP | 12.30 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.74 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|