C28H27F6N2O+ — CID 71665317
(R)-[(2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 71665317) has the molecular formula C28H27F6N2O+ and a molecular weight of 521.53 g/mol. Its IUPAC name is (R)-[(2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (R)-[(2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 71665317 |
| Molecular Formula | C28H27F6N2O+ |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (R)-[(2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N+]2(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C28H27F6N2O/c1-2-18-16-36(15-17-11-20(27(29,30)31)14-21(12-17)28(32,33)34)10-8-19(18)13-25(36)26(37)23-7-9-35-24-6-4-3-5-22(23)24/h2-7,9,11-12,14,18-19,25-26,37H,1,8,10,13,15-16H2/q+1/t18-,19-,25-,26+,36?/m0/s1 |
| InChIKey | NENDKISITPLPDR-MWSATIFJSA-N |
| XLogP | 6.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|