C34H45N2O+ — CID 102298878
(S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 102298878) has the molecular formula C34H45N2O+ and a molecular weight of 497.75 g/mol. Its IUPAC name is (S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 102298878 |
| Molecular Formula | C34H45N2O+ |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | (S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C34H45N2O/c1-8-24-22-36(21-23-17-26(33(2,3)4)20-27(18-23)34(5,6)7)16-14-25(24)19-31(36)32(37)29-13-15-35-30-12-10-9-11-28(29)30/h8-13,15,17-18,20,24-25,31-32,37H,1,14,16,19,21-22H2,2-7H3/q+1/t24-,25-,31+,32-,36+/m0/s1 |
| InChIKey | HQLLQBJAIBYYDX-PDKPTAIOSA-N |
| XLogP | 7.47 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|