C35H47BrN2O2 — CID 46877766
(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide (PubChem CID 46877766) has the molecular formula C35H47BrN2O2 and a molecular weight of 607.68 g/mol. Its IUPAC name is (R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide.
| Compound Name | (R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
|---|---|
| PubChem CID | 46877766 |
| Molecular Formula | C35H47BrN2O2 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | (R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
| SMILES | C=C[C@H]1C[N+]2(Cc3cc(C(C)(C)C)c(OC)c(C(C)(C)C)c3)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12.[Br-] |
| InChI | InChI=1S/C35H47N2O2.BrH/c1-9-24-22-37(21-23-18-28(34(2,3)4)33(39-8)29(19-23)35(5,6)7)17-15-25(24)20-31(37)32(38)27-14-16-36-30-13-11-10-12-26(27)30;/h9-14,16,18-19,24-25,31-32,38H,1,15,17,20-22H2,2-8H3;1H/q+1;/p-1/t24-,25-,31-,32+,37?;/m0./s1 |
| InChIKey | FNSYPBCCPNJWMD-PEXINONNSA-M |
| XLogP | 4.49 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|