C42H53N2O2+ — CID 11083027
4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline (PubChem CID 11083027) has the molecular formula C42H53N2O2+ and a molecular weight of 617.90 g/mol. Its IUPAC name is 4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline |
|---|---|
| PubChem CID | 11083027 |
| Molecular Formula | C42H53N2O2+ |
| Molecular Weight | 617.90 g/mol |
| Exact Mass | 617.41 |
| IUPAC Name | 4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline |
| SMILES | C=C[C@H]1C[N+]2(Cc3cc(C(C)(C)C)c(OC)c(C(C)(C)C)c3)CC[C@H]1C[C@H]2[C@H](OCc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C42H53N2O2/c1-9-31-27-44(26-30-23-35(41(2,3)4)40(45-8)36(24-30)42(5,6)7)22-20-32(31)25-38(44)39(46-28-29-15-11-10-12-16-29)34-19-21-43-37-18-14-13-17-33(34)37/h9-19,21,23-24,31-32,38-39H,1,20,22,25-28H2,2-8H3/q+1/t31-,32-,38-,39+,44?/m0/s1 |
| InChIKey | MERAXBYJOYQTOA-GXDYWCDVSA-N |
| XLogP | 9.71 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.90 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|