C33H35N2O+ — CID 22865333
4-[(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline (PubChem CID 22865333) has the molecular formula C33H35N2O+ and a molecular weight of 475.66 g/mol. Its IUPAC name is 4-[(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline |
|---|---|
| PubChem CID | 22865333 |
| Molecular Formula | C33H35N2O+ |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 4-[(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline |
| SMILES | C=C[C@H]1C[N+]2(Cc3ccccc3)CC[C@H]1C[C@H]2[C@H](OCc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C33H35N2O/c1-2-27-23-35(22-25-11-5-3-6-12-25)20-18-28(27)21-32(35)33(36-24-26-13-7-4-8-14-26)30-17-19-34-31-16-10-9-15-29(30)31/h2-17,19,27-28,32-33H,1,18,20-24H2/q+1/t27-,28-,32-,33+,35?/m0/s1 |
| InChIKey | MHRQKGQOJACTNN-RGIDCAIDSA-N |
| XLogP | 7.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|