C35H33F6N2O2+ — CID 102233248
4-[(R)-[(1S,2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-ol (PubChem CID 102233248) has the molecular formula C35H33F6N2O2+ and a molecular weight of 627.65 g/mol. Its IUPAC name is 4-[(R)-[(1S,2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-ol.
| Compound Name | 4-[(R)-[(1S,2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-ol |
|---|---|
| PubChem CID | 102233248 |
| Molecular Formula | C35H33F6N2O2+ |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 4-[(R)-[(1S,2S,4S,5R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-ol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC[C@H]1C[C@H]2[C@H](OCc1ccccc1)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C35H32F6N2O2/c1-2-24-20-43(19-23-14-26(34(36,37)38)17-27(15-23)35(39,40)41)13-11-25(24)16-32(43)33(45-21-22-6-4-3-5-7-22)29-10-12-42-31-9-8-28(44)18-30(29)31/h2-10,12,14-15,17-18,24-25,32-33H,1,11,13,16,19-21H2/p+1/t24-,25-,32-,33+,43+/m0/s1 |
| InChIKey | BJEOWROEHRYTLD-VJGAVOSNSA-O |
| XLogP | 8.85 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|