C38H53BrN2O2 — CID 71698090
4-[(S)-butoxy-[(2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol bromide (PubChem CID 71698090) has the molecular formula C38H53BrN2O2 and a molecular weight of 649.76 g/mol. Its IUPAC name is 4-[(S)-butoxy-[(2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol bromide.
| Compound Name | 4-[(S)-butoxy-[(2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol bromide |
|---|---|
| PubChem CID | 71698090 |
| Molecular Formula | C38H53BrN2O2 |
| Molecular Weight | 649.76 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | 4-[(S)-butoxy-[(2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol bromide |
| SMILES | C=C[C@H]1C[N+]2(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3)CC[C@H]1C[C@@H]2[C@@H](OCCCC)c1ccnc2ccc(O)cc12.[Br-] |
| InChI | InChI=1S/C38H52N2O2.BrH/c1-9-11-18-42-36(32-14-16-39-34-13-12-31(41)23-33(32)34)35-21-28-15-17-40(35,25-27(28)10-2)24-26-19-29(37(3,4)5)22-30(20-26)38(6,7)8;/h10,12-14,16,19-20,22-23,27-28,35-36H,2,9,11,15,17-18,21,24-25H2,1,3-8H3;1H/t27-,28-,35+,36-,40?;/m0./s1 |
| InChIKey | LTLKUNAQKITBLO-BWJJFNBSSA-N |
| XLogP | 6.01 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|