C39H53N2O3+ — CID 101173000
4-[(R)-[(2S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]-6-methoxyquinoline (PubChem CID 101173000) has the molecular formula C39H53N2O3+ and a molecular weight of 597.86 g/mol. Its IUPAC name is 4-[(R)-[(2S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]-6-methoxyquinoline.
| Compound Name | 4-[(R)-[(2S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 101173000 |
| Molecular Formula | C39H53N2O3+ |
| Molecular Weight | 597.86 g/mol |
| Exact Mass | 597.41 |
| IUPAC Name | 4-[(R)-[(2S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]-6-methoxyquinoline |
| SMILES | C=CCO[C@H](c1ccnc2ccc(OC)cc12)[C@@H]1CC2CC[N+]1(Cc1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)C[C@@H]2C=C |
| InChI | InChI=1S/C39H53N2O3/c1-11-19-44-36(30-15-17-40-34-14-13-29(42-9)23-31(30)34)35-22-28-16-18-41(35,25-27(28)12-2)24-26-20-32(38(3,4)5)37(43-10)33(21-26)39(6,7)8/h11-15,17,20-21,23,27-28,35-36H,1-2,16,18-19,22,24-25H2,3-10H3/q+1/t27-,28?,35-,36+,41?/m0/s1 |
| InChIKey | QVELLXCEDAWQGU-KDTMNRRKSA-N |
| XLogP | 8.70 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.86 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|