C35H46N2O2 — CID 10346798
(R)-[(1R,2S,4R,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanolate (PubChem CID 10346798) has the molecular formula C35H46N2O2 and a molecular weight of 526.77 g/mol. Its IUPAC name is (R)-[(1R,2S,4R,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanolate.
| Compound Name | (R)-[(1R,2S,4R,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanolate |
|---|---|
| PubChem CID | 10346798 |
| Molecular Formula | C35H46N2O2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | (R)-[(1R,2S,4R,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanolate |
| SMILES | C=C[C@H]1C[N@@+]2(Cc3cc(C(C)(C)C)c(OC)c(C(C)(C)C)c3)CC[C@@H]1C[C@H]2[C@H]([O-])c1ccnc2ccccc12 |
| InChI | InChI=1S/C35H46N2O2/c1-9-24-22-37(21-23-18-28(34(2,3)4)33(39-8)29(19-23)35(5,6)7)17-15-25(24)20-31(37)32(38)27-14-16-36-30-13-11-10-12-26(27)30/h9-14,16,18-19,24-25,31-32H,1,15,17,20-22H2,2-8H3/t24-,25+,31-,32+,37-/m0/s1 |
| InChIKey | XRVDMTJSDOHQIB-YOOVZEQISA-N |
| XLogP | 6.85 |
| TPSA | 45.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|