C35H35ClN2O2 — CID 53378098
(R)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride (PubChem CID 53378098) has the molecular formula C35H35ClN2O2 and a molecular weight of 551.13 g/mol. Its IUPAC name is (R)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride.
| Compound Name | (R)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride |
|---|---|
| PubChem CID | 53378098 |
| Molecular Formula | C35H35ClN2O2 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (R)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride |
| SMILES | C=CC1C[N+]2(Cc3c4ccccc4cc4ccccc34)CCC1CC2[C@H]([O-])c1ccnc2ccc(OC)cc12.Cl |
| InChI | InChI=1S/C35H34N2O2.ClH/c1-3-23-21-37(22-32-28-10-6-4-8-25(28)18-26-9-5-7-11-29(26)32)17-15-24(23)19-34(37)35(38)30-14-16-36-33-13-12-27(39-2)20-31(30)33;/h3-14,16,18,20,23-24,34-35H,1,15,17,19,21-22H2,2H3;1H/t23?,24?,34?,35-,37?;/m1./s1 |
| InChIKey | HNSOCWPOGNCZBC-SNHHGDPKSA-N |
| XLogP | 6.98 |
| TPSA | 45.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|