C37H37N2O+ — CID 122580701
4-[[(1S,2S,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline (PubChem CID 122580701) has the molecular formula C37H37N2O+ and a molecular weight of 525.72 g/mol. Its IUPAC name is 4-[[(1S,2S,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline.
| Compound Name | 4-[[(1S,2S,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
|---|---|
| PubChem CID | 122580701 |
| Molecular Formula | C37H37N2O+ |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 4-[[(1S,2S,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
| SMILES | C=CCOC(c1ccnc2ccccc12)[C@@H]1C[C@@H]2CC[N@@+]1(Cc1c3ccccc3cc3ccccc13)C[C@@H]2C=C |
| InChI | InChI=1S/C37H37N2O/c1-3-21-40-37(33-17-19-38-35-16-10-9-15-32(33)35)36-23-27-18-20-39(36,24-26(27)4-2)25-34-30-13-7-5-11-28(30)22-29-12-6-8-14-31(29)34/h3-17,19,22,26-27,36-37H,1-2,18,20-21,23-25H2/q+1/t26-,27-,36-,37?,39-/m0/s1 |
| InChIKey | FMZHUVRPDSGQIP-AZUGKSDKSA-N |
| XLogP | 8.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|