C35H35N2O+ — CID 101150374
4-[(R)-[(1S,2R,4S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]quinoline (PubChem CID 101150374) has the molecular formula C35H35N2O+ and a molecular weight of 499.68 g/mol. Its IUPAC name is 4-[(R)-[(1S,2R,4S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(1S,2R,4S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]quinoline |
|---|---|
| PubChem CID | 101150374 |
| Molecular Formula | C35H35N2O+ |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 4-[(R)-[(1S,2R,4S)-1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]quinoline |
| SMILES | C=CC1C[N@+]2(Cc3c4ccccc4cc4ccccc34)CC[C@H]1C[C@@H]2[C@H](OC)c1ccnc2ccccc12 |
| InChI | InChI=1S/C35H35N2O/c1-3-24-22-37(23-32-28-12-6-4-10-26(28)20-27-11-5-7-13-29(27)32)19-17-25(24)21-34(37)35(38-2)31-16-18-36-33-15-9-8-14-30(31)33/h3-16,18,20,24-25,34-35H,1,17,19,21-23H2,2H3/q+1/t24?,25-,34+,35+,37-/m0/s1 |
| InChIKey | YPHWJAFPZYBBQW-CMBSJVGJSA-N |
| XLogP | 7.84 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|