C31H39ClN2O5 — CID 53377654
(R)-[5-ethenyl-1-[(3-ethoxy-4,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride (PubChem CID 53377654) has the molecular formula C31H39ClN2O5 and a molecular weight of 555.12 g/mol. Its IUPAC name is (R)-[5-ethenyl-1-[(3-ethoxy-4,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride.
| Compound Name | (R)-[5-ethenyl-1-[(3-ethoxy-4,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride |
|---|---|
| PubChem CID | 53377654 |
| Molecular Formula | C31H39ClN2O5 |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | (R)-[5-ethenyl-1-[(3-ethoxy-4,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanolate;hydrochloride |
| SMILES | C=CC1C[N+]2(Cc3cc(OC)c(OC)c(OCC)c3)CCC1CC2[C@H]([O-])c1ccnc2ccc(OC)cc12.Cl |
| InChI | InChI=1S/C31H38N2O5.ClH/c1-6-21-19-33(18-20-14-28(36-4)31(37-5)29(15-20)38-7-2)13-11-22(21)16-27(33)30(34)24-10-12-32-26-9-8-23(35-3)17-25(24)26;/h6,8-10,12,14-15,17,21-22,27,30H,1,7,11,13,16,18-19H2,2-5H3;1H/t21?,22?,27?,30-,33?;/m1./s1 |
| InChIKey | QJFKBYDBMLROHE-ZRDXNLROSA-N |
| XLogP | 5.09 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|