C54H69N2O+ — CID 166444074
(S)-[(2R,4S,5R)-1-[[3,5-bis(3,5-ditert-butylphenyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 166444074) has the molecular formula C54H69N2O+ and a molecular weight of 762.16 g/mol. Its IUPAC name is (S)-[(2R,4S,5R)-1-[[3,5-bis(3,5-ditert-butylphenyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (S)-[(2R,4S,5R)-1-[[3,5-bis(3,5-ditert-butylphenyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 166444074 |
| Molecular Formula | C54H69N2O+ |
| Molecular Weight | 762.16 g/mol |
| Exact Mass | 761.54 |
| IUPAC Name | (S)-[(2R,4S,5R)-1-[[3,5-bis(3,5-ditert-butylphenyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N+]2(Cc3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C54H69N2O/c1-14-36-34-56(22-20-37(36)30-49(56)50(57)47-19-21-55-48-18-16-15-17-46(47)48)33-35-23-38(40-26-42(51(2,3)4)31-43(27-40)52(5,6)7)25-39(24-35)41-28-44(53(8,9)10)32-45(29-41)54(11,12)13/h14-19,21,23-29,31-32,36-37,49-50,57H,1,20,22,30,33-34H2,2-13H3/q+1/t36-,37-,49+,50-,56?/m0/s1 |
| InChIKey | YKPHYOZTTINEMR-UKMOGBBKSA-N |
| XLogP | 13.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.16 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|