C32H41Br2N2O2Si+ — CID 170903354
(S)-[(1S,2R,4S,5R)-1-[[3,5-dibromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 170903354) has the molecular formula C32H41Br2N2O2Si+ and a molecular weight of 673.59 g/mol. Its IUPAC name is (S)-[(1S,2R,4S,5R)-1-[[3,5-dibromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (S)-[(1S,2R,4S,5R)-1-[[3,5-dibromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 170903354 |
| Molecular Formula | C32H41Br2N2O2Si+ |
| Molecular Weight | 673.59 g/mol |
| Exact Mass | 671.13 |
| IUPAC Name | (S)-[(1S,2R,4S,5R)-1-[[3,5-dibromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(Br)c(O[Si](C)(C)C(C)(C)C)c(Br)c3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C32H41Br2N2O2Si/c1-7-22-20-36(19-21-16-26(33)31(27(34)17-21)38-39(5,6)32(2,3)4)15-13-23(22)18-29(36)30(37)25-12-14-35-28-11-9-8-10-24(25)28/h7-12,14,16-17,22-23,29-30,37H,1,13,15,18-20H2,2-6H3/q+1/t22-,23-,29+,30-,36+/m0/s1 |
| InChIKey | UEPKDYSYINLOAS-DEJBAHIGSA-N |
| XLogP | 8.79 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.59 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|