C26H28FN2O+ — CID 135085186
(R)-[5-ethenyl-1-[(4-fluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 135085186) has the molecular formula C26H28FN2O+ and a molecular weight of 403.52 g/mol. Its IUPAC name is (R)-[5-ethenyl-1-[(4-fluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (R)-[5-ethenyl-1-[(4-fluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 135085186 |
| Molecular Formula | C26H28FN2O+ |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (R)-[5-ethenyl-1-[(4-fluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=CC1C[N+]2(Cc3ccc(F)cc3)CCC1CC2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H28FN2O/c1-2-19-17-29(16-18-7-9-21(27)10-8-18)14-12-20(19)15-25(29)26(30)23-11-13-28-24-6-4-3-5-22(23)24/h2-11,13,19-20,25-26,30H,1,12,14-17H2/q+1/t19?,20?,25?,26-,29?/m1/s1 |
| InChIKey | XEZQSWGAWHCCJP-QNSQCWDQSA-N |
| XLogP | 5.02 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|