C27H28BrN3O — CID 22849593
4-[[(2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide (PubChem CID 22849593) has the molecular formula C27H28BrN3O and a molecular weight of 490.45 g/mol. Its IUPAC name is 4-[[(2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide.
| Compound Name | 4-[[(2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide |
|---|---|
| PubChem CID | 22849593 |
| Molecular Formula | C27H28BrN3O |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 4-[[(2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide |
| SMILES | C=C[C@H]1C[N+]2(Cc3ccc(C#N)cc3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12.[Br-] |
| InChI | InChI=1S/C27H28N3O.BrH/c1-2-21-18-30(17-20-9-7-19(16-28)8-10-20)14-12-22(21)15-26(30)27(31)24-11-13-29-25-6-4-3-5-23(24)25;/h2-11,13,21-22,26-27,31H,1,12,14-15,17-18H2;1H/q+1;/p-1/t21-,22-,26+,27-,30?;/m0./s1 |
| InChIKey | LYWHCLCCBYTTFW-WPNHISLKSA-M |
| XLogP | 1.76 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|