C26H28N3O3+ — CID 101113537
(R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 101113537) has the molecular formula C26H28N3O3+ and a molecular weight of 430.53 g/mol. Its IUPAC name is (R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 101113537 |
| Molecular Formula | C26H28N3O3+ |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (R)-[(1S,2R,4S,5R)-5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3ccc([N+](=O)[O-])cc3)CC[C@H]1C[C@@H]2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H28N3O3/c1-2-19-17-29(16-18-7-9-21(10-8-18)28(31)32)14-12-20(19)15-25(29)26(30)23-11-13-27-24-6-4-3-5-22(23)24/h2-11,13,19-20,25-26,30H,1,12,14-17H2/q+1/t19-,20-,25+,26+,29+/m0/s1 |
| InChIKey | HJSJHLGZLYQRDP-BCNOYAONSA-N |
| XLogP | 4.79 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|