C26H28BrN3O3 — CID 135084802
(R)-[5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide (PubChem CID 135084802) has the molecular formula C26H28BrN3O3 and a molecular weight of 510.43 g/mol. Its IUPAC name is (R)-[5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide.
| Compound Name | (R)-[5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
|---|---|
| PubChem CID | 135084802 |
| Molecular Formula | C26H28BrN3O3 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | (R)-[5-ethenyl-1-[(4-nitrophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol bromide |
| SMILES | C=CC1C[N+]2(Cc3ccc([N+](=O)[O-])cc3)CCC1CC2[C@H](O)c1ccnc2ccccc12.[Br-] |
| InChI | InChI=1S/C26H28N3O3.BrH/c1-2-19-17-29(16-18-7-9-21(10-8-18)28(31)32)14-12-20(19)15-25(29)26(30)23-11-13-27-24-6-4-3-5-22(23)24;/h2-11,13,19-20,25-26,30H,1,12,14-17H2;1H/q+1;/p-1/t19?,20?,25?,26-,29?;/m1./s1 |
| InChIKey | RRFHYIZRDLWTEO-DJDVJADSSA-M |
| XLogP | 1.79 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|