C26H26F3N2O2+ — CID 162397274
4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol (PubChem CID 162397274) has the molecular formula C26H26F3N2O2+ and a molecular weight of 455.50 g/mol. Its IUPAC name is 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol.
| Compound Name | 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol |
|---|---|
| PubChem CID | 162397274 |
| Molecular Formula | C26H26F3N2O2+ |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(F)c(F)c(F)c3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C26H25F3N2O2/c1-2-16-14-31(13-15-9-21(27)25(29)22(28)10-15)8-6-17(16)11-24(31)26(33)19-5-7-30-23-4-3-18(32)12-20(19)23/h2-5,7,9-10,12,16-17,24,26,33H,1,6,8,11,13-14H2/p+1/t16-,17-,24+,26-,31+/m0/s1 |
| InChIKey | CXPOCMLTLBOEOI-MHCUARLVSA-O |
| XLogP | 5.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|