C42H45N2O3+ — CID 149242996
4-[(S)-[5-ethenyl-1-[[4-(2-methylpropoxy)-3,5-diphenylphenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol (PubChem CID 149242996) has the molecular formula C42H45N2O3+ and a molecular weight of 625.83 g/mol. Its IUPAC name is 4-[(S)-[5-ethenyl-1-[[4-(2-methylpropoxy)-3,5-diphenylphenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol.
| Compound Name | 4-[(S)-[5-ethenyl-1-[[4-(2-methylpropoxy)-3,5-diphenylphenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol |
|---|---|
| PubChem CID | 149242996 |
| Molecular Formula | C42H45N2O3+ |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 4-[(S)-[5-ethenyl-1-[[4-(2-methylpropoxy)-3,5-diphenylphenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol |
| SMILES | C=CC1C[N+]2(Cc3cc(-c4ccccc4)c(OCC(C)C)c(-c4ccccc4)c3)CCC1CC2[C@@H](O)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C42H44N2O3/c1-4-30-26-44(20-18-33(30)23-40(44)41(46)35-17-19-43-39-16-15-34(45)24-38(35)39)25-29-21-36(31-11-7-5-8-12-31)42(47-27-28(2)3)37(22-29)32-13-9-6-10-14-32/h4-17,19,21-22,24,28,30,33,40-41,46H,1,18,20,23,25-27H2,2-3H3/p+1/t30?,33?,40?,41-,44?/m0/s1 |
| InChIKey | BFACZRYDEGRFKD-YVTWOJEGSA-O |
| XLogP | 8.95 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|