C29H32ClN2O+ — CID 50924938
4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline (PubChem CID 50924938) has the molecular formula C29H32ClN2O+ and a molecular weight of 460.04 g/mol. Its IUPAC name is 4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline.
| Compound Name | 4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
|---|---|
| PubChem CID | 50924938 |
| Molecular Formula | C29H32ClN2O+ |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
| SMILES | C=CCO[C@@H](c1ccnc2ccccc12)[C@H]1C[C@@H]2CC[N+]1(Cc1cccc(Cl)c1)C[C@@H]2C=C |
| InChI | InChI=1S/C29H32ClN2O/c1-3-16-33-29(26-12-14-31-27-11-6-5-10-25(26)27)28-18-23-13-15-32(28,20-22(23)4-2)19-21-8-7-9-24(30)17-21/h3-12,14,17,22-23,28-29H,1-2,13,15-16,18-20H2/q+1/t22-,23-,28+,29-,32?/m0/s1 |
| InChIKey | MPFKEHZDDNVIOC-XZGCSQERSA-N |
| XLogP | 6.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|