C29H30BrClN2O — CID 50924943
4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-ynoxymethyl]quinoline bromide (PubChem CID 50924943) has the molecular formula C29H30BrClN2O and a molecular weight of 537.93 g/mol. Its IUPAC name is 4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-ynoxymethyl]quinoline bromide.
| Compound Name | 4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-ynoxymethyl]quinoline bromide |
|---|---|
| PubChem CID | 50924943 |
| Molecular Formula | C29H30BrClN2O |
| Molecular Weight | 537.93 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 4-[(S)-[(2R,4S,5R)-1-[(3-chlorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-ynoxymethyl]quinoline bromide |
| SMILES | C#CCO[C@@H](c1ccnc2ccccc12)[C@H]1C[C@@H]2CC[N+]1(Cc1cccc(Cl)c1)C[C@@H]2C=C.[Br-] |
| InChI | InChI=1S/C29H30ClN2O.BrH/c1-3-16-33-29(26-12-14-31-27-11-6-5-10-25(26)27)28-18-23-13-15-32(28,20-22(23)4-2)19-21-8-7-9-24(30)17-21;/h1,4-12,14,17,22-23,28-29H,2,13,15-16,18-20H2;1H/q+1;/p-1/t22-,23-,28+,29-,32?;/m0./s1 |
| InChIKey | SWBMXZKKRFHEGR-WQNVZVIPSA-M |
| XLogP | 3.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|