C34H36N3O2+ — CID 170905026
2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-phenylmethoxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-N-phenylacetamide (PubChem CID 170905026) has the molecular formula C34H36N3O2+ and a molecular weight of 518.68 g/mol. Its IUPAC name is 2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-phenylmethoxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-phenylmethoxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 170905026 |
| Molecular Formula | C34H36N3O2+ |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-phenylmethoxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-N-phenylacetamide |
| SMILES | C=C[C@H]1C[N@+]2(CC(=O)Nc3ccccc3)CC[C@H]1C[C@@H]2[C@@H](OCc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C34H35N3O2/c1-2-26-22-37(23-33(38)36-28-13-7-4-8-14-28)20-18-27(26)21-32(37)34(39-24-25-11-5-3-6-12-25)30-17-19-35-31-16-10-9-15-29(30)31/h2-17,19,26-27,32,34H,1,18,20-24H2/p+1/t26-,27-,32+,34-,37-/m0/s1 |
| InChIKey | ROGNXOYSEBFVAQ-NMXLXZKWSA-O |
| XLogP | 6.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|