C25H34BrN3O2 — CID 172868593
N-tert-butyl-2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]acetamide bromide (PubChem CID 172868593) has the molecular formula C25H34BrN3O2 and a molecular weight of 488.47 g/mol. Its IUPAC name is N-tert-butyl-2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]acetamide bromide.
| Compound Name | N-tert-butyl-2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]acetamide bromide |
|---|---|
| PubChem CID | 172868593 |
| Molecular Formula | C25H34BrN3O2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-tert-butyl-2-[(1S,2R,4S,5R)-5-ethenyl-2-[(S)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]acetamide bromide |
| SMILES | C=C[C@H]1C[N@+]2(CC(=O)NC(C)(C)C)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12.[Br-] |
| InChI | InChI=1S/C25H33N3O2.BrH/c1-5-17-15-28(16-23(29)27-25(2,3)4)13-11-18(17)14-22(28)24(30)20-10-12-26-21-9-7-6-8-19(20)21;/h5-10,12,17-18,22,24,30H,1,11,13-16H2,2-4H3;1H/t17-,18-,22+,24-,28-;/m0./s1 |
| InChIKey | GBDTVCZRQRNYGD-ANEDKCASSA-N |
| XLogP | 0.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|